C12H28 — CID 159506310
methane;(3S,4R)-3-methyl-4-propan-2-ylheptane (PubChem CID 159506310) has the molecular formula C12H28 and a molecular weight of 172.36 g/mol. Its IUPAC name is methane;(3S,4R)-3-methyl-4-propan-2-ylheptane.
| Compound Name | methane;(3S,4R)-3-methyl-4-propan-2-ylheptane |
|---|---|
| PubChem CID | 159506310 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | methane;(3S,4R)-3-methyl-4-propan-2-ylheptane |
| SMILES | C.CCC[C@H](C(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C11H24.CH4/c1-6-8-11(9(3)4)10(5)7-2;/h9-11H,6-8H2,1-5H3;1H4/t10-,11+;/m0./s1 |
| InChIKey | MAAOLJUQLUTXCR-VZXYPILPSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |