C9H22 — CID 159261482
(3R,4R)-3,4-dimethylhexane;methane (PubChem CID 159261482) has the molecular formula C9H22 and a molecular weight of 130.27 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethylhexane;methane.
| Compound Name | (3R,4R)-3,4-dimethylhexane;methane |
|---|---|
| PubChem CID | 159261482 |
| Molecular Formula | C9H22 |
| Molecular Weight | 130.27 g/mol |
| Exact Mass | 130.17 |
| IUPAC Name | (3R,4R)-3,4-dimethylhexane;methane |
| SMILES | C.CC[C@@H](C)[C@H](C)CC |
| InChI | InChI=1S/C8H18.CH4/c1-5-7(3)8(4)6-2;/h7-8H,5-6H2,1-4H3;1H4/t7-,8-;/m1./s1 |
| InChIKey | KWOJFQGMVCCGQS-SCLLHFNJSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |