C10H25Al — CID 174508217
alumane;2,4,5-trimethylheptane (PubChem CID 174508217) has the molecular formula C10H25Al and a molecular weight of 172.29 g/mol. Its IUPAC name is alumane;2,4,5-trimethylheptane.
| Compound Name | alumane;2,4,5-trimethylheptane |
|---|---|
| PubChem CID | 174508217 |
| Molecular Formula | C10H25Al |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | alumane;2,4,5-trimethylheptane |
| SMILES | CCC(C)C(C)CC(C)C.[AlH3] |
| InChI | InChI=1S/C10H22.Al.3H/c1-6-9(4)10(5)7-8(2)3;;;;/h8-10H,6-7H2,1-5H3;;;; |
| InChIKey | DJAGDOHAUUNXRT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |