C13H28O — CID 156689826
2,4,6,7-tetramethylnonan-5-ol (PubChem CID 156689826) has the molecular formula C13H28O and a molecular weight of 200.37 g/mol. Its IUPAC name is 2,4,6,7-tetramethylnonan-5-ol.
| Compound Name | 2,4,6,7-tetramethylnonan-5-ol |
|---|---|
| PubChem CID | 156689826 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 2,4,6,7-tetramethylnonan-5-ol |
| SMILES | CCC(C)C(C)C(O)C(C)CC(C)C |
| InChI | InChI=1S/C13H28O/c1-7-10(4)12(6)13(14)11(5)8-9(2)3/h9-14H,7-8H2,1-6H3 |
| InChIKey | CDBYQJSALCAASX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |