About 8-methylnonane-3,4,5,6-tetrol
8-methylnonane-3,4,5,6-tetrol (PubChem CID 88909679) has the molecular formula C10H22O4
and a molecular weight of 206.28 g/mol. Its IUPAC name is 8-methylnonane-3,4,5,6-tetrol.
Molecular Properties
| Compound Name | 8-methylnonane-3,4,5,6-tetrol |
| PubChem CID | 88909679 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 8-methylnonane-3,4,5,6-tetrol |
| SMILES | CCC(O)C(O)C(O)C(O)CC(C)C |
| InChI | InChI=1S/C10H22O4/c1-4-7(11)9(13)10(14)8(12)5-6(2)3/h6-14H,4-5H2,1-3H3 |
| InChIKey | VXVQWBOZKUXMKU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methylnonane-3,4,5,6-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnonane-3,4,5,6-tetrol?
The IUPAC name of 8-methylnonane-3,4,5,6-tetrol (CID 88909679) is 8-methylnonane-3,4,5,6-tetrol.
What is the SMILES notation for 8-methylnonane-3,4,5,6-tetrol?
The canonical SMILES for 8-methylnonane-3,4,5,6-tetrol is CCC(O)C(O)C(O)C(O)CC(C)C.
What is the InChIKey of 8-methylnonane-3,4,5,6-tetrol?
The InChIKey is VXVQWBOZKUXMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4/c1-4-7(11)9(13)10(14)8(12)5-6(2)3/h6-14H,4-5H2,1-3H3.
What are the key properties of 8-methylnonane-3,4,5,6-tetrol?
8-methylnonane-3,4,5,6-tetrol has a molecular weight of 206.28 g/mol, XLogP of -0.11, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnonane-3,4,5,6-tetrol is sourced from PubChem (CID 88909679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).