C10H22O4 — CID 88909679
8-methylnonane-3,4,5,6-tetrol (PubChem CID 88909679) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 8-methylnonane-3,4,5,6-tetrol.
| Compound Name | 8-methylnonane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 88909679 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 8-methylnonane-3,4,5,6-tetrol |
| SMILES | CCC(O)C(O)C(O)C(O)CC(C)C |
| InChI | InChI=1S/C10H22O4/c1-4-7(11)9(13)10(14)8(12)5-6(2)3/h6-14H,4-5H2,1-3H3 |
| InChIKey | VXVQWBOZKUXMKU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |