C10H22O3S2 — CID 118442091
(2S,3R,4R)-1,1-bis(ethylsulfanyl)hexane-2,3,4-triol (PubChem CID 118442091) has the molecular formula C10H22O3S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is (2S,3R,4R)-1,1-bis(ethylsulfanyl)hexane-2,3,4-triol.
| Compound Name | (2S,3R,4R)-1,1-bis(ethylsulfanyl)hexane-2,3,4-triol |
|---|---|
| PubChem CID | 118442091 |
| Molecular Formula | C10H22O3S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (2S,3R,4R)-1,1-bis(ethylsulfanyl)hexane-2,3,4-triol |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)CC |
| InChI | InChI=1S/C10H22O3S2/c1-4-7(11)8(12)9(13)10(14-5-2)15-6-3/h7-13H,4-6H2,1-3H3/t7-,8-,9+/m1/s1 |
| InChIKey | NLDLFFIZRLDWST-HLTSFMKQSA-N |
| XLogP | 1.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|