C12H26O7S2 — CID 121012727
(2R,3S,4S,5R,6R,7S)-8,8-bis(ethylsulfanyl)octane-1,2,3,4,5,6,7-heptol (PubChem CID 121012727) has the molecular formula C12H26O7S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R,7S)-8,8-bis(ethylsulfanyl)octane-1,2,3,4,5,6,7-heptol.
| Compound Name | (2R,3S,4S,5R,6R,7S)-8,8-bis(ethylsulfanyl)octane-1,2,3,4,5,6,7-heptol |
|---|---|
| PubChem CID | 121012727 |
| Molecular Formula | C12H26O7S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (2R,3S,4S,5R,6R,7S)-8,8-bis(ethylsulfanyl)octane-1,2,3,4,5,6,7-heptol |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H26O7S2/c1-3-20-12(21-4-2)11(19)10(18)9(17)8(16)7(15)6(14)5-13/h6-19H,3-5H2,1-2H3/t6-,7+,8+,9-,10-,11+/m1/s1 |
| InChIKey | ZSEWRIVLPSASIS-HVXHNJHYSA-N |
| XLogP | -2.02 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|