C12H28O6 — CID 88787528
hexane;hexane-1,2,3,4,5,6-hexol (PubChem CID 88787528) has the molecular formula C12H28O6 and a molecular weight of 268.35 g/mol. Its IUPAC name is hexane;hexane-1,2,3,4,5,6-hexol.
| Compound Name | hexane;hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 88787528 |
| Molecular Formula | C12H28O6 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | hexane;hexane-1,2,3,4,5,6-hexol |
| SMILES | CCCCCC.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14O6.C6H14/c7-1-3(9)5(11)6(12)4(10)2-8;1-3-5-6-4-2/h3-12H,1-2H2;3-6H2,1-2H3 |
| InChIKey | UCCWWZZUNIKZST-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|