C19H40O5 — CID 135030850
(2S,3R,4R,5R)-nonadecane-1,2,3,4,5-pentol (PubChem CID 135030850) has the molecular formula C19H40O5 and a molecular weight of 348.52 g/mol. Its IUPAC name is (2S,3R,4R,5R)-nonadecane-1,2,3,4,5-pentol.
| Compound Name | (2S,3R,4R,5R)-nonadecane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 135030850 |
| Molecular Formula | C19H40O5 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | (2S,3R,4R,5R)-nonadecane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCCCCCCC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C19H40O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(21)18(23)19(24)17(22)15-20/h16-24H,2-15H2,1H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | DEHYWHSKUNSZPG-FCGDIQPGSA-N |
| XLogP | 2.51 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|