C16H35NO3 — CID 163003966
(2S,3S,4S)-2-aminohexadecane-1,3,4-triol (PubChem CID 163003966) has the molecular formula C16H35NO3 and a molecular weight of 289.46 g/mol. Its IUPAC name is (2S,3S,4S)-2-aminohexadecane-1,3,4-triol.
| Compound Name | (2S,3S,4S)-2-aminohexadecane-1,3,4-triol |
|---|---|
| PubChem CID | 163003966 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | (2S,3S,4S)-2-aminohexadecane-1,3,4-triol |
| SMILES | CCCCCCCCCCCC[C@H](O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C16H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-15(19)16(20)14(17)13-18/h14-16,18-20H,2-13,17H2,1H3/t14-,15-,16-/m0/s1 |
| InChIKey | OCHZTELGZBWSJD-JYJNAYRXSA-N |
| XLogP | 2.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|