C18H39NO3 — CID 123143330
(2R,3S)-2-aminooctadecane-1,3,4-triol (PubChem CID 123143330) has the molecular formula C18H39NO3 and a molecular weight of 317.51 g/mol. Its IUPAC name is (2R,3S)-2-aminooctadecane-1,3,4-triol.
| Compound Name | (2R,3S)-2-aminooctadecane-1,3,4-triol |
|---|---|
| PubChem CID | 123143330 |
| Molecular Formula | C18H39NO3 |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.29 |
| IUPAC Name | (2R,3S)-2-aminooctadecane-1,3,4-triol |
| SMILES | CCCCCCCCCCCCCCC(O)[C@@H](O)[C@H](N)CO |
| InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17?,18+/m1/s1 |
| InChIKey | AERBNCYCJBRYDG-BLAYRMRBSA-N |
| XLogP | 3.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|