C15H33NO2 — CID 71424335
(2S)-2-aminopentadecane-1,3-diol (PubChem CID 71424335) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is (2S)-2-aminopentadecane-1,3-diol.
| Compound Name | (2S)-2-aminopentadecane-1,3-diol |
|---|---|
| PubChem CID | 71424335 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | (2S)-2-aminopentadecane-1,3-diol |
| SMILES | CCCCCCCCCCCCC(O)[C@@H](N)CO |
| InChI | InChI=1S/C15H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-15(18)14(16)13-17/h14-15,17-18H,2-13,16H2,1H3/t14-,15?/m0/s1 |
| InChIKey | JWOGAYKGDUNEHP-MLCCFXAWSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|