C19H41NO2 — CID 24740674
(2S,3S)-2-amino-17-methyloctadecane-1,3-diol (PubChem CID 24740674) has the molecular formula C19H41NO2 and a molecular weight of 315.54 g/mol. Its IUPAC name is (2S,3S)-2-amino-17-methyloctadecane-1,3-diol.
| Compound Name | (2S,3S)-2-amino-17-methyloctadecane-1,3-diol |
|---|---|
| PubChem CID | 24740674 |
| Molecular Formula | C19H41NO2 |
| Molecular Weight | 315.54 g/mol |
| Exact Mass | 315.31 |
| IUPAC Name | (2S,3S)-2-amino-17-methyloctadecane-1,3-diol |
| SMILES | CC(C)CCCCCCCCCCCCC[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C19H41NO2/c1-17(2)14-12-10-8-6-4-3-5-7-9-11-13-15-19(22)18(20)16-21/h17-19,21-22H,3-16,20H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | LVFJDXPLLXORPU-OALUTQOASA-N |
| XLogP | 4.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|