C15H33NO — CID 118735808
(4S,5R)-4-amino-2-methyltetradecan-5-ol (PubChem CID 118735808) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is (4S,5R)-4-amino-2-methyltetradecan-5-ol.
| Compound Name | (4S,5R)-4-amino-2-methyltetradecan-5-ol |
|---|---|
| PubChem CID | 118735808 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | (4S,5R)-4-amino-2-methyltetradecan-5-ol |
| SMILES | CCCCCCCCC[C@@H](O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C15H33NO/c1-4-5-6-7-8-9-10-11-15(17)14(16)12-13(2)3/h13-15,17H,4-12,16H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | QDIFBPZIKXNYRP-LSDHHAIUSA-N |
| XLogP | 3.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|