C13H29NO — CID 10584805
(4S,5S)-4-aminotridecan-5-ol (PubChem CID 10584805) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is (4S,5S)-4-aminotridecan-5-ol.
| Compound Name | (4S,5S)-4-aminotridecan-5-ol |
|---|---|
| PubChem CID | 10584805 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | (4S,5S)-4-aminotridecan-5-ol |
| SMILES | CCCCCCCC[C@H](O)[C@@H](N)CCC |
| InChI | InChI=1S/C13H29NO/c1-3-5-6-7-8-9-11-13(15)12(14)10-4-2/h12-13,15H,3-11,14H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | CBJNPUYVJTZVGT-STQMWFEESA-N |
| XLogP | 3.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|