C9H21NO2 — CID 87704254
3-aminononane-1,4-diol (PubChem CID 87704254) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 3-aminononane-1,4-diol.
| Compound Name | 3-aminononane-1,4-diol |
|---|---|
| PubChem CID | 87704254 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 3-aminononane-1,4-diol |
| SMILES | CCCCCC(O)C(N)CCO |
| InChI | InChI=1S/C9H21NO2/c1-2-3-4-5-9(12)8(10)6-7-11/h8-9,11-12H,2-7,10H2,1H3 |
| InChIKey | QODQZWIUAXGSKP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|