About 10,18-diaminooctadecan-9-ol
10,18-diaminooctadecan-9-ol (PubChem CID 19842914) has the molecular formula C18H40N2O
and a molecular weight of 300.53 g/mol. Its IUPAC name is 10,18-diaminooctadecan-9-ol.
Molecular Properties
| Compound Name | 10,18-diaminooctadecan-9-ol |
| PubChem CID | 19842914 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | 10,18-diaminooctadecan-9-ol |
| SMILES | CCCCCCCCC(O)C(N)CCCCCCCCN |
| InChI | InChI=1S/C18H40N2O/c1-2-3-4-5-9-12-15-18(21)17(20)14-11-8-6-7-10-13-16-19/h17-18,21H,2-16,19-20H2,1H3 |
| InChIKey | JCJTUFROVQWBSR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10,18-diaminooctadecan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,18-diaminooctadecan-9-ol?
The IUPAC name of 10,18-diaminooctadecan-9-ol (CID 19842914) is 10,18-diaminooctadecan-9-ol.
What is the SMILES notation for 10,18-diaminooctadecan-9-ol?
The canonical SMILES for 10,18-diaminooctadecan-9-ol is CCCCCCCCC(O)C(N)CCCCCCCCN.
What is the InChIKey of 10,18-diaminooctadecan-9-ol?
The InChIKey is JCJTUFROVQWBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N2O/c1-2-3-4-5-9-12-15-18(21)17(20)14-11-8-6-7-10-13-16-19/h17-18,21H,2-16,19-20H2,1H3.
What are the key properties of 10,18-diaminooctadecan-9-ol?
10,18-diaminooctadecan-9-ol has a molecular weight of 300.53 g/mol, XLogP of 4.11, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,18-diaminooctadecan-9-ol is sourced from PubChem (CID 19842914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).