C11H25NO — CID 132514193
(2S,3S)-2-aminoundecan-3-ol (PubChem CID 132514193) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is (2S,3S)-2-aminoundecan-3-ol.
| Compound Name | (2S,3S)-2-aminoundecan-3-ol |
|---|---|
| PubChem CID | 132514193 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | (2S,3S)-2-aminoundecan-3-ol |
| SMILES | CCCCCCCC[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C11H25NO/c1-3-4-5-6-7-8-9-11(13)10(2)12/h10-11,13H,3-9,12H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | WLEYAJSBNRYSFR-QWRGUYRKSA-N |
| XLogP | 2.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|