About 2-aminotetradecan-3-ol
2-aminotetradecan-3-ol (PubChem CID 10198494) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is 2-aminotetradecan-3-ol.
Molecular Properties
| Compound Name | 2-aminotetradecan-3-ol |
| PubChem CID | 10198494 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 2-aminotetradecan-3-ol |
| SMILES | CCCCCCCCCCCC(O)C(C)N |
| InChI | InChI=1S/C14H31NO/c1-3-4-5-6-7-8-9-10-11-12-14(16)13(2)15/h13-14,16H,3-12,15H2,1-2H3 |
| InChIKey | WMUMHAZHWIUBPN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminotetradecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminotetradecan-3-ol?
The IUPAC name of 2-aminotetradecan-3-ol (CID 10198494) is 2-aminotetradecan-3-ol.
What is the SMILES notation for 2-aminotetradecan-3-ol?
The canonical SMILES for 2-aminotetradecan-3-ol is CCCCCCCCCCCC(O)C(C)N.
What is the InChIKey of 2-aminotetradecan-3-ol?
The InChIKey is WMUMHAZHWIUBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO/c1-3-4-5-6-7-8-9-10-11-12-14(16)13(2)15/h13-14,16H,3-12,15H2,1-2H3.
What are the key properties of 2-aminotetradecan-3-ol?
2-aminotetradecan-3-ol has a molecular weight of 229.41 g/mol, XLogP of 3.62, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminotetradecan-3-ol is sourced from PubChem (CID 10198494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).