C17H37NO2 — CID 10085469
(2S,3S)-3-aminoheptadecane-1,2-diol (PubChem CID 10085469) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is (2S,3S)-3-aminoheptadecane-1,2-diol.
| Compound Name | (2S,3S)-3-aminoheptadecane-1,2-diol |
|---|---|
| PubChem CID | 10085469 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | (2S,3S)-3-aminoheptadecane-1,2-diol |
| SMILES | CCCCCCCCCCCCCC[C@H](N)[C@H](O)CO |
| InChI | InChI=1S/C17H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18)17(20)15-19/h16-17,19-20H,2-15,18H2,1H3/t16-,17+/m0/s1 |
| InChIKey | UIGBLHZVXJZZQE-DLBZAZTESA-N |
| XLogP | 3.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|