C10H22O3 — CID 12619492
(2S,3S)-decane-1,2,3-triol (PubChem CID 12619492) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is (2S,3S)-decane-1,2,3-triol.
| Compound Name | (2S,3S)-decane-1,2,3-triol |
|---|---|
| PubChem CID | 12619492 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | (2S,3S)-decane-1,2,3-triol |
| SMILES | CCCCCCC[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H22O3/c1-2-3-4-5-6-7-9(12)10(13)8-11/h9-13H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | NRQTTYGIVFAJLQ-UWVGGRQHSA-N |
| XLogP | 1.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|