C12H26O4 — CID 175058574
dodecane-1,2,4,5-tetrol (PubChem CID 175058574) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is dodecane-1,2,4,5-tetrol.
| Compound Name | dodecane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 175058574 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | dodecane-1,2,4,5-tetrol |
| SMILES | CCCCCCCC(O)C(O)CC(O)CO |
| InChI | InChI=1S/C12H26O4/c1-2-3-4-5-6-7-11(15)12(16)8-10(14)9-13/h10-16H,2-9H2,1H3 |
| InChIKey | FQFNRRYMBIJAIO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|