C10H23NO3 — CID 101249167
(4R,5S)-4-aminodecane-1,2,5-triol (PubChem CID 101249167) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (4R,5S)-4-aminodecane-1,2,5-triol.
| Compound Name | (4R,5S)-4-aminodecane-1,2,5-triol |
|---|---|
| PubChem CID | 101249167 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | (4R,5S)-4-aminodecane-1,2,5-triol |
| SMILES | CCCCC[C@H](O)[C@H](N)CC(O)CO |
| InChI | InChI=1S/C10H23NO3/c1-2-3-4-5-10(14)9(11)6-8(13)7-12/h8-10,12-14H,2-7,11H2,1H3/t8?,9-,10+/m1/s1 |
| InChIKey | NMBUEKDJGKWIEY-XVBQNVSMSA-N |
| XLogP | -0.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|