C8H20N2O2 — CID 57166953
3,8-diaminooctane-1,4-diol (PubChem CID 57166953) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3,8-diaminooctane-1,4-diol.
| Compound Name | 3,8-diaminooctane-1,4-diol |
|---|---|
| PubChem CID | 57166953 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 3,8-diaminooctane-1,4-diol |
| SMILES | NCCCCC(O)C(N)CCO |
| InChI | InChI=1S/C8H20N2O2/c9-5-2-1-3-8(12)7(10)4-6-11/h7-8,11-12H,1-6,9-10H2 |
| InChIKey | FAAJDFUWEQWWTN-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|