C12H30N4 — CID 124604183
(6R,7S)-dodecane-1,6,7,12-tetramine (PubChem CID 124604183) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is (6R,7S)-dodecane-1,6,7,12-tetramine.
| Compound Name | (6R,7S)-dodecane-1,6,7,12-tetramine |
|---|---|
| PubChem CID | 124604183 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | (6R,7S)-dodecane-1,6,7,12-tetramine |
| SMILES | NCCCCC[C@@H](N)[C@@H](N)CCCCCN |
| InChI | InChI=1S/C12H30N4/c13-9-5-1-3-7-11(15)12(16)8-4-2-6-10-14/h11-12H,1-10,13-16H2/t11-,12+ |
| InChIKey | IBFISXWMMUEZCG-TXEJJXNPSA-N |
| XLogP | 0.68 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|