About 1-iododecane-1,10-diamine
1-iododecane-1,10-diamine (PubChem CID 175279846) has the molecular formula C10H23IN2
and a molecular weight of 298.21 g/mol. Its IUPAC name is 1-iododecane-1,10-diamine.
Molecular Properties
| Compound Name | 1-iododecane-1,10-diamine |
| PubChem CID | 175279846 |
| Molecular Formula | C10H23IN2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-iododecane-1,10-diamine |
| SMILES | NCCCCCCCCCC(N)I |
| InChI | InChI=1S/C10H23IN2/c11-10(13)8-6-4-2-1-3-5-7-9-12/h10H,1-9,12-13H2 |
| InChIKey | ZFLCHEXYEHYQOY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iododecane-1,10-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iododecane-1,10-diamine?
The IUPAC name of 1-iododecane-1,10-diamine (CID 175279846) is 1-iododecane-1,10-diamine.
What is the SMILES notation for 1-iododecane-1,10-diamine?
The canonical SMILES for 1-iododecane-1,10-diamine is NCCCCCCCCCC(N)I.
What is the InChIKey of 1-iododecane-1,10-diamine?
The InChIKey is ZFLCHEXYEHYQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23IN2/c11-10(13)8-6-4-2-1-3-5-7-9-12/h10H,1-9,12-13H2.
What are the key properties of 1-iododecane-1,10-diamine?
1-iododecane-1,10-diamine has a molecular weight of 298.21 g/mol, XLogP of 2.79, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iododecane-1,10-diamine is sourced from PubChem (CID 175279846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).