C8H21N3 — CID 18544198
octane-1,4,8-triamine (PubChem CID 18544198) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is octane-1,4,8-triamine.
| Compound Name | octane-1,4,8-triamine |
|---|---|
| PubChem CID | 18544198 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | octane-1,4,8-triamine |
| SMILES | NCCCCC(N)CCCN |
| InChI | InChI=1S/C8H21N3/c9-6-2-1-4-8(11)5-3-7-10/h8H,1-7,9-11H2 |
| InChIKey | MKXQGNOFNPQKIX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|