C7H23Cl4N3 — CID 172714614
heptane-1,4,7-triamine;tetrahydrochloride (PubChem CID 172714614) has the molecular formula C7H23Cl4N3 and a molecular weight of 291.09 g/mol. Its IUPAC name is heptane-1,4,7-triamine;tetrahydrochloride.
| Compound Name | heptane-1,4,7-triamine;tetrahydrochloride |
|---|---|
| PubChem CID | 172714614 |
| Molecular Formula | C7H23Cl4N3 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | heptane-1,4,7-triamine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.NCCCC(N)CCCN |
| InChI | InChI=1S/C7H19N3.4ClH/c8-5-1-3-7(10)4-2-6-9;;;;/h7H,1-6,8-10H2;4*1H |
| InChIKey | FRSHRCCINGQVMH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |