C13H33N5 — CID 172704929
7-N-[3-(3-aminopropylamino)propyl]heptane-1,4,7-triamine (PubChem CID 172704929) has the molecular formula C13H33N5 and a molecular weight of 259.44 g/mol. Its IUPAC name is 7-N-[3-(3-aminopropylamino)propyl]heptane-1,4,7-triamine.
| Compound Name | 7-N-[3-(3-aminopropylamino)propyl]heptane-1,4,7-triamine |
|---|---|
| PubChem CID | 172704929 |
| Molecular Formula | C13H33N5 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.27 |
| IUPAC Name | 7-N-[3-(3-aminopropylamino)propyl]heptane-1,4,7-triamine |
| SMILES | NCCCNCCCNCCCC(N)CCCN |
| InChI | InChI=1S/C13H33N5/c14-7-1-5-13(16)6-2-9-17-11-4-12-18-10-3-8-15/h13,17-18H,1-12,14-16H2 |
| InChIKey | DLMWZVBVLCKMLM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|