C12H29N3 — CID 87991067
6-N-hexylhexane-1,3,6-triamine (PubChem CID 87991067) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is 6-N-hexylhexane-1,3,6-triamine.
| Compound Name | 6-N-hexylhexane-1,3,6-triamine |
|---|---|
| PubChem CID | 87991067 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | 6-N-hexylhexane-1,3,6-triamine |
| SMILES | CCCCCCNCCCC(N)CCN |
| InChI | InChI=1S/C12H29N3/c1-2-3-4-5-10-15-11-6-7-12(14)8-9-13/h12,15H,2-11,13-14H2,1H3 |
| InChIKey | CJSINRWJLHMNLU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|