C16H36N2 — CID 113337396
3-ethyl-N'-octylhexane-1,6-diamine (PubChem CID 113337396) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 3-ethyl-N'-octylhexane-1,6-diamine.
| Compound Name | 3-ethyl-N'-octylhexane-1,6-diamine |
|---|---|
| PubChem CID | 113337396 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | 3-ethyl-N'-octylhexane-1,6-diamine |
| SMILES | CCCCCCCCNCCCC(CC)CCN |
| InChI | InChI=1S/C16H36N2/c1-3-5-6-7-8-9-14-18-15-10-11-16(4-2)12-13-17/h16,18H,3-15,17H2,1-2H3 |
| InChIKey | LNZOFBBOVGDFIR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|