C14H33N3 — CID 59929730
N'-[3-(2-ethylhexylamino)propyl]propane-1,3-diamine (PubChem CID 59929730) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is N'-[3-(2-ethylhexylamino)propyl]propane-1,3-diamine.
| Compound Name | N'-[3-(2-ethylhexylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 59929730 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | N'-[3-(2-ethylhexylamino)propyl]propane-1,3-diamine |
| SMILES | CCCCC(CC)CNCCCNCCCN |
| InChI | InChI=1S/C14H33N3/c1-3-5-8-14(4-2)13-17-12-7-11-16-10-6-9-15/h14,16-17H,3-13,15H2,1-2H3 |
| InChIKey | PORAFGMRWDOGLJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|