C11H27N3 — CID 142717096
3-N-(2-ethylhexyl)propane-1,1,3-triamine (PubChem CID 142717096) has the molecular formula C11H27N3 and a molecular weight of 201.36 g/mol. Its IUPAC name is 3-N-(2-ethylhexyl)propane-1,1,3-triamine.
| Compound Name | 3-N-(2-ethylhexyl)propane-1,1,3-triamine |
|---|---|
| PubChem CID | 142717096 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | 3-N-(2-ethylhexyl)propane-1,1,3-triamine |
| SMILES | CCCCC(CC)CNCCC(N)N |
| InChI | InChI=1S/C11H27N3/c1-3-5-6-10(4-2)9-14-8-7-11(12)13/h10-11,14H,3-9,12-13H2,1-2H3 |
| InChIKey | DYMOZUWESDFBKU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|