C13H33N5 — CID 86224803
tridecane-1,4,7,10,13-pentamine (PubChem CID 86224803) has the molecular formula C13H33N5 and a molecular weight of 259.44 g/mol. Its IUPAC name is tridecane-1,4,7,10,13-pentamine.
| Compound Name | tridecane-1,4,7,10,13-pentamine |
|---|---|
| PubChem CID | 86224803 |
| Molecular Formula | C13H33N5 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.27 |
| IUPAC Name | tridecane-1,4,7,10,13-pentamine |
| SMILES | NCCCC(N)CCC(N)CCC(N)CCCN |
| InChI | InChI=1S/C13H33N5/c14-9-1-3-11(16)5-7-13(18)8-6-12(17)4-2-10-15/h11-13H,1-10,14-18H2 |
| InChIKey | OMQVUZKQULXYMF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |