About hexane-1,4-diamine;trihydrate
hexane-1,4-diamine;trihydrate (PubChem CID 173409010) has the molecular formula C6H22N2O3
and a molecular weight of 170.25 g/mol. Its IUPAC name is hexane-1,4-diamine;trihydrate.
Molecular Properties
| Compound Name | hexane-1,4-diamine;trihydrate |
| PubChem CID | 173409010 |
| Molecular Formula | C6H22N2O3 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.16 |
| IUPAC Name | hexane-1,4-diamine;trihydrate |
| SMILES | CCC(N)CCCN.O.O.O |
| InChI | InChI=1S/C6H16N2.3H2O/c1-2-6(8)4-3-5-7;;;/h6H,2-5,7-8H2,1H3;3*1H2 |
| InChIKey | NZNWUNYDLBLNMR-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexane-1,4-diamine;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,4-diamine;trihydrate?
The IUPAC name of hexane-1,4-diamine;trihydrate (CID 173409010) is hexane-1,4-diamine;trihydrate.
What is the SMILES notation for hexane-1,4-diamine;trihydrate?
The canonical SMILES for hexane-1,4-diamine;trihydrate is CCC(N)CCCN.O.O.O.
What is the InChIKey of hexane-1,4-diamine;trihydrate?
The InChIKey is NZNWUNYDLBLNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.3H2O/c1-2-6(8)4-3-5-7;;;/h6H,2-5,7-8H2,1H3;3*1H2.
What are the key properties of hexane-1,4-diamine;trihydrate?
hexane-1,4-diamine;trihydrate has a molecular weight of 170.25 g/mol, XLogP of -2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,4-diamine;trihydrate is sourced from PubChem (CID 173409010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).