C14H34N4 — CID 140993886
tetradecane-3,6,9,12-tetramine (PubChem CID 140993886) has the molecular formula C14H34N4 and a molecular weight of 258.45 g/mol. Its IUPAC name is tetradecane-3,6,9,12-tetramine.
| Compound Name | tetradecane-3,6,9,12-tetramine |
|---|---|
| PubChem CID | 140993886 |
| Molecular Formula | C14H34N4 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.28 |
| IUPAC Name | tetradecane-3,6,9,12-tetramine |
| SMILES | CCC(N)CCC(N)CCC(N)CCC(N)CC |
| InChI | InChI=1S/C14H34N4/c1-3-11(15)5-7-13(17)9-10-14(18)8-6-12(16)4-2/h11-14H,3-10,15-18H2,1-2H3 |
| InChIKey | YAJNFGRRIGDPLL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |