About ethane;hexan-3-amine;methane
ethane;hexan-3-amine;methane (PubChem CID 145152462) has the molecular formula C9H25N
and a molecular weight of 147.31 g/mol. Its IUPAC name is ethane;hexan-3-amine;methane.
Molecular Properties
| Compound Name | ethane;hexan-3-amine;methane |
| PubChem CID | 145152462 |
| Molecular Formula | C9H25N |
| Molecular Weight | 147.31 g/mol |
| Exact Mass | 147.20 |
| IUPAC Name | ethane;hexan-3-amine;methane |
| SMILES | C.CC.CCCC(N)CC |
| InChI | InChI=1S/C6H15N.C2H6.CH4/c1-3-5-6(7)4-2;1-2;/h6H,3-5,7H2,1-2H3;1-2H3;1H4 |
| InChIKey | HUBHAJXGFDDRKY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;hexan-3-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hexan-3-amine;methane?
The IUPAC name of ethane;hexan-3-amine;methane (CID 145152462) is ethane;hexan-3-amine;methane.
What is the SMILES notation for ethane;hexan-3-amine;methane?
The canonical SMILES for ethane;hexan-3-amine;methane is C.CC.CCCC(N)CC.
What is the InChIKey of ethane;hexan-3-amine;methane?
The InChIKey is HUBHAJXGFDDRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H6.CH4/c1-3-5-6(7)4-2;1-2;/h6H,3-5,7H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;hexan-3-amine;methane?
ethane;hexan-3-amine;methane has a molecular weight of 147.31 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hexan-3-amine;methane is sourced from PubChem (CID 145152462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).