About cyclohexa-3,5-diene-1,2-dione;hexan-3-amine
cyclohexa-3,5-diene-1,2-dione;hexan-3-amine (PubChem CID 175120215) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dione;hexan-3-amine.
Molecular Properties
| Compound Name | cyclohexa-3,5-diene-1,2-dione;hexan-3-amine |
| PubChem CID | 175120215 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dione;hexan-3-amine |
| SMILES | CCCC(N)CC.O=C1C=CC=CC1=O |
| InChI | InChI=1S/C6H15N.C6H4O2/c1-3-5-6(7)4-2;7-5-3-1-2-4-6(5)8/h6H,3-5,7H2,1-2H3;1-4H |
| InChIKey | IEBRCWNHCRKCQU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-3,5-diene-1,2-dione;hexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-3,5-diene-1,2-dione;hexan-3-amine?
The IUPAC name of cyclohexa-3,5-diene-1,2-dione;hexan-3-amine (CID 175120215) is cyclohexa-3,5-diene-1,2-dione;hexan-3-amine.
What is the SMILES notation for cyclohexa-3,5-diene-1,2-dione;hexan-3-amine?
The canonical SMILES for cyclohexa-3,5-diene-1,2-dione;hexan-3-amine is CCCC(N)CC.O=C1C=CC=CC1=O.
What is the InChIKey of cyclohexa-3,5-diene-1,2-dione;hexan-3-amine?
The InChIKey is IEBRCWNHCRKCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C6H4O2/c1-3-5-6(7)4-2;7-5-3-1-2-4-6(5)8/h6H,3-5,7H2,1-2H3;1-4H.
What are the key properties of cyclohexa-3,5-diene-1,2-dione;hexan-3-amine?
cyclohexa-3,5-diene-1,2-dione;hexan-3-amine has a molecular weight of 209.29 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-3,5-diene-1,2-dione;hexan-3-amine is sourced from PubChem (CID 175120215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).