C12H19NO2 — CID 175120215
cyclohexa-3,5-diene-1,2-dione;hexan-3-amine (PubChem CID 175120215) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dione;hexan-3-amine.
| Compound Name | cyclohexa-3,5-diene-1,2-dione;hexan-3-amine |
|---|---|
| PubChem CID | 175120215 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dione;hexan-3-amine |
| SMILES | CCCC(N)CC.O=C1C=CC=CC1=O |
| InChI | InChI=1S/C6H15N.C6H4O2/c1-3-5-6(7)4-2;7-5-3-1-2-4-6(5)8/h6H,3-5,7H2,1-2H3;1-4H |
| InChIKey | IEBRCWNHCRKCQU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|