About azane;heptan-4-amine
azane;heptan-4-amine (PubChem CID 118430725) has the molecular formula C7H20N2
and a molecular weight of 132.25 g/mol. Its IUPAC name is azane;heptan-4-amine.
Molecular Properties
| Compound Name | azane;heptan-4-amine |
| PubChem CID | 118430725 |
| Molecular Formula | C7H20N2 |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.16 |
| IUPAC Name | azane;heptan-4-amine |
| SMILES | CCCC(N)CCC.N |
| InChI | InChI=1S/C7H17N.H3N/c1-3-5-7(8)6-4-2;/h7H,3-6,8H2,1-2H3;1H3 |
| InChIKey | VZHOIKTULAXOHV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;heptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;heptan-4-amine?
The IUPAC name of azane;heptan-4-amine (CID 118430725) is azane;heptan-4-amine.
What is the SMILES notation for azane;heptan-4-amine?
The canonical SMILES for azane;heptan-4-amine is CCCC(N)CCC.N.
What is the InChIKey of azane;heptan-4-amine?
The InChIKey is VZHOIKTULAXOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N.H3N/c1-3-5-7(8)6-4-2;/h7H,3-6,8H2,1-2H3;1H3.
What are the key properties of azane;heptan-4-amine?
azane;heptan-4-amine has a molecular weight of 132.25 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;heptan-4-amine is sourced from PubChem (CID 118430725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).