About tetradecane-3,11-diamine
tetradecane-3,11-diamine (PubChem CID 170279817) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is tetradecane-3,11-diamine.
Molecular Properties
| Compound Name | tetradecane-3,11-diamine |
| PubChem CID | 170279817 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | tetradecane-3,11-diamine |
| SMILES | CCCC(N)CCCCCCCC(N)CC |
| InChI | InChI=1S/C14H32N2/c1-3-10-14(16)12-9-7-5-6-8-11-13(15)4-2/h13-14H,3-12,15-16H2,1-2H3 |
| InChIKey | DSUNCPPCEURXCZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecane-3,11-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecane-3,11-diamine?
The IUPAC name of tetradecane-3,11-diamine (CID 170279817) is tetradecane-3,11-diamine.
What is the SMILES notation for tetradecane-3,11-diamine?
The canonical SMILES for tetradecane-3,11-diamine is CCCC(N)CCCCCCCC(N)CC.
What is the InChIKey of tetradecane-3,11-diamine?
The InChIKey is DSUNCPPCEURXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2/c1-3-10-14(16)12-9-7-5-6-8-11-13(15)4-2/h13-14H,3-12,15-16H2,1-2H3.
What are the key properties of tetradecane-3,11-diamine?
tetradecane-3,11-diamine has a molecular weight of 228.42 g/mol, XLogP of 3.58, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecane-3,11-diamine is sourced from PubChem (CID 170279817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).