About heptadecan-4-amine;hydrochloride
heptadecan-4-amine;hydrochloride (PubChem CID 173248342) has the molecular formula C17H38ClN
and a molecular weight of 291.95 g/mol. Its IUPAC name is heptadecan-4-amine;hydrochloride.
Molecular Properties
| Compound Name | heptadecan-4-amine;hydrochloride |
| PubChem CID | 173248342 |
| Molecular Formula | C17H38ClN |
| Molecular Weight | 291.95 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | heptadecan-4-amine;hydrochloride |
| SMILES | CCCCCCCCCCCCCC(N)CCC.Cl |
| InChI | InChI=1S/C17H37N.ClH/c1-3-5-6-7-8-9-10-11-12-13-14-16-17(18)15-4-2;/h17H,3-16,18H2,1-2H3;1H |
| InChIKey | XYKWATHNEDLGOX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.95 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptadecan-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecan-4-amine;hydrochloride?
The IUPAC name of heptadecan-4-amine;hydrochloride (CID 173248342) is heptadecan-4-amine;hydrochloride.
What is the SMILES notation for heptadecan-4-amine;hydrochloride?
The canonical SMILES for heptadecan-4-amine;hydrochloride is CCCCCCCCCCCCCC(N)CCC.Cl.
What is the InChIKey of heptadecan-4-amine;hydrochloride?
The InChIKey is XYKWATHNEDLGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N.ClH/c1-3-5-6-7-8-9-10-11-12-13-14-16-17(18)15-4-2;/h17H,3-16,18H2,1-2H3;1H.
What are the key properties of heptadecan-4-amine;hydrochloride?
heptadecan-4-amine;hydrochloride has a molecular weight of 291.95 g/mol, XLogP of 6.24, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecan-4-amine;hydrochloride is sourced from PubChem (CID 173248342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).