About henicosane-8,14-diamine;dihydrochloride
henicosane-8,14-diamine;dihydrochloride (PubChem CID 170909168) has the molecular formula C21H48Cl2N2
and a molecular weight of 399.54 g/mol. Its IUPAC name is henicosane-8,14-diamine;dihydrochloride.
Molecular Properties
| Compound Name | henicosane-8,14-diamine;dihydrochloride |
| PubChem CID | 170909168 |
| Molecular Formula | C21H48Cl2N2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | henicosane-8,14-diamine;dihydrochloride |
| SMILES | CCCCCCCC(N)CCCCCC(N)CCCCCCC.Cl.Cl |
| InChI | InChI=1S/C21H46N2.2ClH/c1-3-5-7-9-12-16-20(22)18-14-11-15-19-21(23)17-13-10-8-6-4-2;;/h20-21H,3-19,22-23H2,1-2H3;2*1H |
| InChIKey | OPABVPBKNDKQKU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze henicosane-8,14-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosane-8,14-diamine;dihydrochloride?
The IUPAC name of henicosane-8,14-diamine;dihydrochloride (CID 170909168) is henicosane-8,14-diamine;dihydrochloride.
What is the SMILES notation for henicosane-8,14-diamine;dihydrochloride?
The canonical SMILES for henicosane-8,14-diamine;dihydrochloride is CCCCCCCC(N)CCCCCC(N)CCCCCCC.Cl.Cl.
What is the InChIKey of henicosane-8,14-diamine;dihydrochloride?
The InChIKey is OPABVPBKNDKQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H46N2.2ClH/c1-3-5-7-9-12-16-20(22)18-14-11-15-19-21(23)17-13-10-8-6-4-2;;/h20-21H,3-19,22-23H2,1-2H3;2*1H.
What are the key properties of henicosane-8,14-diamine;dihydrochloride?
henicosane-8,14-diamine;dihydrochloride has a molecular weight of 399.54 g/mol, XLogP of 7.16, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for henicosane-8,14-diamine;dihydrochloride is sourced from PubChem (CID 170909168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).