About octadecane-1,5-diamine
octadecane-1,5-diamine (PubChem CID 154229011) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is octadecane-1,5-diamine.
Molecular Properties
| Compound Name | octadecane-1,5-diamine |
| PubChem CID | 154229011 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | octadecane-1,5-diamine |
| SMILES | CCCCCCCCCCCCCC(N)CCCCN |
| InChI | InChI=1S/C18H40N2/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(20)16-13-14-17-19/h18H,2-17,19-20H2,1H3 |
| InChIKey | NTKJNYCCFVYZRM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecane-1,5-diamine?
The IUPAC name of octadecane-1,5-diamine (CID 154229011) is octadecane-1,5-diamine.
What is the SMILES notation for octadecane-1,5-diamine?
The canonical SMILES for octadecane-1,5-diamine is CCCCCCCCCCCCCC(N)CCCCN.
What is the InChIKey of octadecane-1,5-diamine?
The InChIKey is NTKJNYCCFVYZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N2/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(20)16-13-14-17-19/h18H,2-17,19-20H2,1H3.
What are the key properties of octadecane-1,5-diamine?
octadecane-1,5-diamine has a molecular weight of 284.53 g/mol, XLogP of 5.14, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecane-1,5-diamine is sourced from PubChem (CID 154229011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).