C24H56N4 — CID 88743619
dodecane-1,2-diamine;dodecane-1,12-diamine (PubChem CID 88743619) has the molecular formula C24H56N4 and a molecular weight of 400.74 g/mol. Its IUPAC name is dodecane-1,2-diamine;dodecane-1,12-diamine.
| Compound Name | dodecane-1,2-diamine;dodecane-1,12-diamine |
|---|---|
| PubChem CID | 88743619 |
| Molecular Formula | C24H56N4 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.45 |
| IUPAC Name | dodecane-1,2-diamine;dodecane-1,12-diamine |
| SMILES | CCCCCCCCCCC(N)CN.NCCCCCCCCCCCCN |
| InChI | InChI=1S/2C12H28N2/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;13-11-9-7-5-3-1-2-4-6-8-10-12-14/h12H,2-11,13-14H2,1H3;1-14H2 |
| InChIKey | AAGQWBPTXICQAS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|