About decane-1,2-diamine
decane-1,2-diamine (PubChem CID 517618) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is decane-1,2-diamine.
Molecular Properties
| Compound Name | decane-1,2-diamine |
| PubChem CID | 517618 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | decane-1,2-diamine |
| SMILES | CCCCCCCCC(N)CN |
| InChI | InChI=1S/C10H24N2/c1-2-3-4-5-6-7-8-10(12)9-11/h10H,2-9,11-12H2,1H3 |
| InChIKey | ZTEKCBPGTUUQOB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-1,2-diamine?
The IUPAC name of decane-1,2-diamine (CID 517618) is decane-1,2-diamine.
What is the SMILES notation for decane-1,2-diamine?
The canonical SMILES for decane-1,2-diamine is CCCCCCCCC(N)CN.
What is the InChIKey of decane-1,2-diamine?
The InChIKey is ZTEKCBPGTUUQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-2-3-4-5-6-7-8-10(12)9-11/h10H,2-9,11-12H2,1H3.
What are the key properties of decane-1,2-diamine?
decane-1,2-diamine has a molecular weight of 172.32 g/mol, XLogP of 2.02, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decane-1,2-diamine is sourced from PubChem (CID 517618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).