About decan-4-amine;hydrochloride
decan-4-amine;hydrochloride (PubChem CID 87728109) has the molecular formula C10H24ClN
and a molecular weight of 193.76 g/mol. Its IUPAC name is decan-4-amine;hydrochloride.
Molecular Properties
| Compound Name | decan-4-amine;hydrochloride |
| PubChem CID | 87728109 |
| Molecular Formula | C10H24ClN |
| Molecular Weight | 193.76 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | decan-4-amine;hydrochloride |
| SMILES | CCCCCCC(N)CCC.Cl |
| InChI | InChI=1S/C10H23N.ClH/c1-3-5-6-7-9-10(11)8-4-2;/h10H,3-9,11H2,1-2H3;1H |
| InChIKey | UQXHHSGFZVIBNL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-4-amine;hydrochloride?
The IUPAC name of decan-4-amine;hydrochloride (CID 87728109) is decan-4-amine;hydrochloride.
What is the SMILES notation for decan-4-amine;hydrochloride?
The canonical SMILES for decan-4-amine;hydrochloride is CCCCCCC(N)CCC.Cl.
What is the InChIKey of decan-4-amine;hydrochloride?
The InChIKey is UQXHHSGFZVIBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.ClH/c1-3-5-6-7-9-10(11)8-4-2;/h10H,3-9,11H2,1-2H3;1H.
What are the key properties of decan-4-amine;hydrochloride?
decan-4-amine;hydrochloride has a molecular weight of 193.76 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decan-4-amine;hydrochloride is sourced from PubChem (CID 87728109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).