C13H32N4 — CID 175128174
tridecane-1,4,7,10-tetramine (PubChem CID 175128174) has the molecular formula C13H32N4 and a molecular weight of 244.43 g/mol. Its IUPAC name is tridecane-1,4,7,10-tetramine.
| Compound Name | tridecane-1,4,7,10-tetramine |
|---|---|
| PubChem CID | 175128174 |
| Molecular Formula | C13H32N4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | tridecane-1,4,7,10-tetramine |
| SMILES | CCCC(N)CCC(N)CCC(N)CCCN |
| InChI | InChI=1S/C13H32N4/c1-2-4-11(15)6-8-13(17)9-7-12(16)5-3-10-14/h11-13H,2-10,14-17H2,1H3 |
| InChIKey | DZOQGUHSKCNWRD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |