About (3S)-3-aminohexan-1-ol;sulfane;hydrochloride
(3S)-3-aminohexan-1-ol;sulfane;hydrochloride (PubChem CID 161031770) has the molecular formula C6H18ClNOS
and a molecular weight of 187.74 g/mol. Its IUPAC name is (3S)-3-aminohexan-1-ol;sulfane;hydrochloride.
Molecular Properties
| Compound Name | (3S)-3-aminohexan-1-ol;sulfane;hydrochloride |
| PubChem CID | 161031770 |
| Molecular Formula | C6H18ClNOS |
| Molecular Weight | 187.74 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (3S)-3-aminohexan-1-ol;sulfane;hydrochloride |
| SMILES | CCC[C@H](N)CCO.Cl.S |
| InChI | InChI=1S/C6H15NO.ClH.H2S/c1-2-3-6(7)4-5-8;;/h6,8H,2-5,7H2,1H3;1H;1H2/t6-;;/m0../s1 |
| InChIKey | HJRWJGQPJAIYAB-ILKKLZGPSA-N |
| XLogP | 1.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.74 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-aminohexan-1-ol;sulfane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminohexan-1-ol;sulfane;hydrochloride?
The IUPAC name of (3S)-3-aminohexan-1-ol;sulfane;hydrochloride (CID 161031770) is (3S)-3-aminohexan-1-ol;sulfane;hydrochloride.
What is the SMILES notation for (3S)-3-aminohexan-1-ol;sulfane;hydrochloride?
The canonical SMILES for (3S)-3-aminohexan-1-ol;sulfane;hydrochloride is CCC[C@H](N)CCO.Cl.S.
What is the InChIKey of (3S)-3-aminohexan-1-ol;sulfane;hydrochloride?
The InChIKey is HJRWJGQPJAIYAB-ILKKLZGPSA-N. The full InChI is InChI=1S/C6H15NO.ClH.H2S/c1-2-3-6(7)4-5-8;;/h6,8H,2-5,7H2,1H3;1H;1H2/t6-;;/m0../s1.
What are the key properties of (3S)-3-aminohexan-1-ol;sulfane;hydrochloride?
(3S)-3-aminohexan-1-ol;sulfane;hydrochloride has a molecular weight of 187.74 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminohexan-1-ol;sulfane;hydrochloride is sourced from PubChem (CID 161031770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).