C6H36N8O2 — CID 173455648
3-aminohexane-1,6-diol;azane (PubChem CID 173455648) has the molecular formula C6H36N8O2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 3-aminohexane-1,6-diol;azane.
| Compound Name | 3-aminohexane-1,6-diol;azane |
|---|---|
| PubChem CID | 173455648 |
| Molecular Formula | C6H36N8O2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.30 |
| IUPAC Name | 3-aminohexane-1,6-diol;azane |
| SMILES | N.N.N.N.N.N.N.NC(CCO)CCCO |
| InChI | InChI=1S/C6H15NO2.7H3N/c7-6(3-5-9)2-1-4-8;;;;;;;/h6,8-9H,1-5,7H2;7*1H3 |
| InChIKey | KUIBIKIODHNIQL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 311.48 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |