C5H15BrN2O — CID 175509083
3,5-diaminopentan-1-ol;hydrobromide (PubChem CID 175509083) has the molecular formula C5H15BrN2O and a molecular weight of 199.09 g/mol. Its IUPAC name is 3,5-diaminopentan-1-ol;hydrobromide.
| Compound Name | 3,5-diaminopentan-1-ol;hydrobromide |
|---|---|
| PubChem CID | 175509083 |
| Molecular Formula | C5H15BrN2O |
| Molecular Weight | 199.09 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3,5-diaminopentan-1-ol;hydrobromide |
| SMILES | Br.NCCC(N)CCO |
| InChI | InChI=1S/C5H14N2O.BrH/c6-3-1-5(7)2-4-8;/h5,8H,1-4,6-7H2;1H |
| InChIKey | QGIGCIGGQPAZNA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.09 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |